C17H19F3N2O5 — CID 142787581
6-[(4-acetylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 142787581) has the molecular formula C17H19F3N2O5 and a molecular weight of 388.34 g/mol. Its IUPAC name is 6-[(4-acetylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | 6-[(4-acetylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 142787581 |
| Molecular Formula | C17H19F3N2O5 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 6-[(4-acetylbenzoyl)amino]-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CC(=O)c1ccc(C(=O)NCCCCC(NC(=O)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C17H19F3N2O5/c1-10(23)11-5-7-12(8-6-11)14(24)21-9-3-2-4-13(15(25)26)22-16(27)17(18,19)20/h5-8,13H,2-4,9H2,1H3,(H,21,24)(H,22,27)(H,25,26) |
| InChIKey | GVCPBIKLAXEWSJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|