C12H25F3N3O3+ — CID 174851283
6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;tetramethylazanium (PubChem CID 174851283) has the molecular formula C12H25F3N3O3+ and a molecular weight of 316.34 g/mol. Its IUPAC name is 6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;tetramethylazanium.
| Compound Name | 6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;tetramethylazanium |
|---|---|
| PubChem CID | 174851283 |
| Molecular Formula | C12H25F3N3O3+ |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;tetramethylazanium |
| SMILES | C[N+](C)(C)C.NCCCCC(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H13F3N2O3.C4H12N/c9-8(10,11)7(16)13-5(6(14)15)3-1-2-4-12;1-5(2,3)4/h5H,1-4,12H2,(H,13,16)(H,14,15);1-4H3/q;+1 |
| InChIKey | PLROOELQJNSLJD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|