C16H33N5O4 — CID 175821686
(2S)-6-amino-2-[[2-[[(2S)-2,6-diaminohexanoyl]amino]-2-methylpropanoyl]amino]hexanoic acid (PubChem CID 175821686) has the molecular formula C16H33N5O4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-2,6-diaminohexanoyl]amino]-2-methylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-2,6-diaminohexanoyl]amino]-2-methylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175821686 |
| Molecular Formula | C16H33N5O4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-2,6-diaminohexanoyl]amino]-2-methylpropanoyl]amino]hexanoic acid |
| SMILES | CC(C)(NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C16H33N5O4/c1-16(2,21-13(22)11(19)7-3-5-9-17)15(25)20-12(14(23)24)8-4-6-10-18/h11-12H,3-10,17-19H2,1-2H3,(H,20,25)(H,21,22)(H,23,24)/t11-,12-/m0/s1 |
| InChIKey | LLQUFGYGBVNUEM-RYUDHWBXSA-N |
| XLogP | -0.96 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|