C8H14F3LiN2O3 — CID 174851964
lithium;(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;hydride (PubChem CID 174851964) has the molecular formula C8H14F3LiN2O3 and a molecular weight of 250.15 g/mol. Its IUPAC name is lithium;(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;hydride.
| Compound Name | lithium;(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;hydride |
|---|---|
| PubChem CID | 174851964 |
| Molecular Formula | C8H14F3LiN2O3 |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | lithium;(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;hydride |
| SMILES | NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C8H13F3N2O3.Li.H/c9-8(10,11)7(16)13-5(6(14)15)3-1-2-4-12;;/h5H,1-4,12H2,(H,13,16)(H,14,15);;/q;+1;-1/t5-;;/m0../s1 |
| InChIKey | DSFPUIWLWSZQKM-XRIGFGBMSA-N |
| XLogP | -2.64 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|