About sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate
sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 141479931) has the molecular formula C8H12F3N2NaO3
and a molecular weight of 264.18 g/mol. Its IUPAC name is sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
Molecular Properties
| Compound Name | sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| PubChem CID | 141479931 |
| Molecular Formula | C8H12F3N2NaO3 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H13F3N2O3.Na/c9-8(10,11)7(16)13-5(6(14)15)3-1-2-4-12;/h5H,1-4,12H2,(H,13,16)(H,14,15);/q;+1/p-1/t5-;/m0./s1 |
| InChIKey | XDFWKKPGNUSSJF-JEDNCBNOSA-M |
| XLogP | -4.08 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The IUPAC name of sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (CID 141479931) is sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
What is the SMILES notation for sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The canonical SMILES for sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate is NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)[O-].[Na+].
What is the InChIKey of sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
The InChIKey is XDFWKKPGNUSSJF-JEDNCBNOSA-M. The full InChI is InChI=1S/C8H13F3N2O3.Na/c9-8(10,11)7(16)13-5(6(14)15)3-1-2-4-12;/h5H,1-4,12H2,(H,13,16)(H,14,15);/q;+1/p-1/t5-;/m0./s1.
What are the key properties of sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate?
sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate has a molecular weight of 264.18 g/mol, XLogP of -4.08, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate is sourced from PubChem (CID 141479931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).