C25H39F3N4O3 — CID 177085173
N-[2-[[6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]ethyl]-3,5-ditert-butylbenzamide (PubChem CID 177085173) has the molecular formula C25H39F3N4O3 and a molecular weight of 500.61 g/mol. Its IUPAC name is N-[2-[[6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]ethyl]-3,5-ditert-butylbenzamide.
| Compound Name | N-[2-[[6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]ethyl]-3,5-ditert-butylbenzamide |
|---|---|
| PubChem CID | 177085173 |
| Molecular Formula | C25H39F3N4O3 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-[2-[[6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoyl]amino]ethyl]-3,5-ditert-butylbenzamide |
| SMILES | CC(C)(C)c1cc(C(=O)NCCNC(=O)C(CCCCN)NC(=O)C(F)(F)F)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H39F3N4O3/c1-23(2,3)17-13-16(14-18(15-17)24(4,5)6)20(33)30-11-12-31-21(34)19(9-7-8-10-29)32-22(35)25(26,27)28/h13-15,19H,7-12,29H2,1-6H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | IXTCOFZGPOWCAZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|