C25H35N3O2 — CID 134135004
N-[4-(3-aminopropylcarbamoyl)phenyl]-3,5-ditert-butylbenzamide (PubChem CID 134135004) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is N-[4-(3-aminopropylcarbamoyl)phenyl]-3,5-ditert-butylbenzamide.
| Compound Name | N-[4-(3-aminopropylcarbamoyl)phenyl]-3,5-ditert-butylbenzamide |
|---|---|
| PubChem CID | 134135004 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | N-[4-(3-aminopropylcarbamoyl)phenyl]-3,5-ditert-butylbenzamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccc(C(=O)NCCCN)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H35N3O2/c1-24(2,3)19-14-18(15-20(16-19)25(4,5)6)23(30)28-21-10-8-17(9-11-21)22(29)27-13-7-12-26/h8-11,14-16H,7,12-13,26H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | QOBOQUVGFGMMER-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|