C7H8F3N2O4- — CID 6993253
(2S)-5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 6993253) has the molecular formula C7H8F3N2O4- and a molecular weight of 241.14 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | (2S)-5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 6993253 |
| Molecular Formula | C7H8F3N2O4- |
| Molecular Weight | 241.14 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | NC(=O)CC[C@H](NC(=O)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H9F3N2O4/c8-7(9,10)6(16)12-3(5(14)15)1-2-4(11)13/h3H,1-2H2,(H2,11,13)(H,12,16)(H,14,15)/p-1/t3-/m0/s1 |
| InChIKey | DZSRTQQASVFEBN-VKHMYHEASA-M |
| XLogP | -1.95 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.14 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |