C5H9N2NaO3S — CID 172718737
sodium (2S)-5-amino-5-oxo-2-(sulfanylamino)pentanoate (PubChem CID 172718737) has the molecular formula C5H9N2NaO3S and a molecular weight of 200.19 g/mol. Its IUPAC name is sodium (2S)-5-amino-5-oxo-2-(sulfanylamino)pentanoate.
| Compound Name | sodium (2S)-5-amino-5-oxo-2-(sulfanylamino)pentanoate |
|---|---|
| PubChem CID | 172718737 |
| Molecular Formula | C5H9N2NaO3S |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | sodium (2S)-5-amino-5-oxo-2-(sulfanylamino)pentanoate |
| SMILES | NC(=O)CC[C@H](NS)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H10N2O3S.Na/c6-4(8)2-1-3(7-11)5(9)10;/h3,7,11H,1-2H2,(H2,6,8)(H,9,10);/q;+1/p-1/t3-;/m0./s1 |
| InChIKey | GFFDJYNZWWNNRQ-DFWYDOINSA-M |
| XLogP | -5.19 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|