C6H11N4NaO3 — CID 142705344
sodium (2S)-5-amino-2-(diaminomethylideneamino)-5-oxopentanoate (PubChem CID 142705344) has the molecular formula C6H11N4NaO3 and a molecular weight of 210.17 g/mol. Its IUPAC name is sodium (2S)-5-amino-2-(diaminomethylideneamino)-5-oxopentanoate.
| Compound Name | sodium (2S)-5-amino-2-(diaminomethylideneamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 142705344 |
| Molecular Formula | C6H11N4NaO3 |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | sodium (2S)-5-amino-2-(diaminomethylideneamino)-5-oxopentanoate |
| SMILES | NC(=O)CC[C@H](N=C(N)N)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H12N4O3.Na/c7-4(11)2-1-3(5(12)13)10-6(8)9;/h3H,1-2H2,(H2,7,11)(H,12,13)(H4,8,9,10);/q;+1/p-1/t3-;/m0./s1 |
| InChIKey | MCMJBZHQUNKHPZ-DFWYDOINSA-M |
| XLogP | -6.35 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|