C18H29N9O10 — CID 91264901
(2S)-5-[5-[(4S)-4-carboxy-4-(diaminomethylideneamino)butanoyl]oxy-4-(diaminomethylideneamino)-5-oxopentanoyl]oxy-2-(diaminomethylideneamino)-5-oxopentanoic acid (PubChem CID 91264901) has the molecular formula C18H29N9O10 and a molecular weight of 531.48 g/mol. Its IUPAC name is (2S)-5-[5-[(4S)-4-carboxy-4-(diaminomethylideneamino)butanoyl]oxy-4-(diaminomethylideneamino)-5-oxopentanoyl]oxy-2-(diaminomethylideneamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-[5-[(4S)-4-carboxy-4-(diaminomethylideneamino)butanoyl]oxy-4-(diaminomethylideneamino)-5-oxopentanoyl]oxy-2-(diaminomethylideneamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91264901 |
| Molecular Formula | C18H29N9O10 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (2S)-5-[5-[(4S)-4-carboxy-4-(diaminomethylideneamino)butanoyl]oxy-4-(diaminomethylideneamino)-5-oxopentanoyl]oxy-2-(diaminomethylideneamino)-5-oxopentanoic acid |
| SMILES | NC(N)=NC(CCC(=O)OC(=O)CC[C@H](N=C(N)N)C(=O)O)C(=O)OC(=O)CC[C@H](N=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H29N9O10/c19-16(20)25-7(13(31)32)1-4-10(28)36-11(29)6-3-9(27-18(23)24)15(35)37-12(30)5-2-8(14(33)34)26-17(21)22/h7-9H,1-6H2,(H,31,32)(H,33,34)(H4,19,20,25)(H4,21,22,26)(H4,23,24,27)/t7-,8-,9?/m0/s1 |
| InChIKey | QLPUWZFPPXULKI-JVIMKECRSA-N |
| XLogP | -4.44 |
| TPSA | 354.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|