C16H27N5O12 — CID 87175217
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;(2S)-2-(diaminomethylideneamino)pentanedioic acid (PubChem CID 87175217) has the molecular formula C16H27N5O12 and a molecular weight of 481.42 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;(2S)-2-(diaminomethylideneamino)pentanedioic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;(2S)-2-(diaminomethylideneamino)pentanedioic acid |
|---|---|
| PubChem CID | 87175217 |
| Molecular Formula | C16H27N5O12 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;(2S)-2-(diaminomethylideneamino)pentanedioic acid |
| SMILES | NC(N)=N[C@@H](CCC(=O)O)C(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C6H11N3O4/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;7-6(8)9-3(5(12)13)1-2-4(10)11/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);3H,1-2H2,(H,10,11)(H,12,13)(H4,7,8,9)/t;3-/m.0/s1 |
| InChIKey | PWBMCPNWEYIPAC-HVDRVSQOSA-N |
| XLogP | -3.49 |
| TPSA | 294.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|