C16H26N2O12 — CID 88599589
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hexanedioic acid (PubChem CID 88599589) has the molecular formula C16H26N2O12 and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hexanedioic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hexanedioic acid |
|---|---|
| PubChem CID | 88599589 |
| Molecular Formula | C16H26N2O12 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hexanedioic acid |
| SMILES | O=C(O)CCCCC(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C6H10O4/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;7-5(8)3-1-2-4-6(9)10/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | BYOAVQCQJDTNEA-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 230.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|