C110H216N2O48 — CID 173206314
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;icosakis(pentanoic acid) (PubChem CID 173206314) has the molecular formula C110H216N2O48 and a molecular weight of 2334.90 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;icosakis(pentanoic acid).
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;icosakis(pentanoic acid) |
|---|---|
| PubChem CID | 173206314 |
| Molecular Formula | C110H216N2O48 |
| Molecular Weight | 2334.90 g/mol |
| Exact Mass | 2333.45 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;icosakis(pentanoic acid) |
| SMILES | CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.CCCCC(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.20C5H10O2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;20*1-2-3-4-5(6)7/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);20*2-4H2,1H3,(H,6,7) |
| InChIKey | BAPAELZILDPVCU-UHFFFAOYSA-N |
| XLogP | 23.15 |
| TPSA | 901.68 Ų |
| H-Bond Donors | 24 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 71 |
| Heavy Atoms | 160 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2334.90 |
| LogP ≤ 5 | 23.15 |
| H-Bond Donors ≤ 5 | 24 |
| H-Bond Acceptors ≤ 10 | 26 |