C10H15NO7 — CID 175510261
(2S)-2-amino-5-(4-carboxybutanoyloxy)-5-oxopentanoic acid (PubChem CID 175510261) has the molecular formula C10H15NO7 and a molecular weight of 261.23 g/mol. Its IUPAC name is (2S)-2-amino-5-(4-carboxybutanoyloxy)-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-(4-carboxybutanoyloxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175510261 |
| Molecular Formula | C10H15NO7 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2S)-2-amino-5-(4-carboxybutanoyloxy)-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)OC(=O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H15NO7/c11-6(10(16)17)4-5-9(15)18-8(14)3-1-2-7(12)13/h6H,1-5,11H2,(H,12,13)(H,16,17)/t6-/m0/s1 |
| InChIKey | RKBSCYPDNADFBJ-LURJTMIESA-N |
| XLogP | -0.50 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|