C11H21N5O5 — CID 57044405
(2S)-2-amino-5-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-5-oxopentanoic acid (PubChem CID 57044405) has the molecular formula C11H21N5O5 and a molecular weight of 303.32 g/mol. Its IUPAC name is (2S)-2-amino-5-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 57044405 |
| Molecular Formula | C11H21N5O5 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2S)-2-amino-5-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-5-oxopentanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)OC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H21N5O5/c12-6(9(18)19)3-4-8(17)21-10(20)7(13)2-1-5-16-11(14)15/h6-7H,1-5,12-13H2,(H,18,19)(H4,14,15,16)/t6-,7-/m0/s1 |
| InChIKey | VTNDPHFIVYAKBL-BQBZGAKWSA-N |
| XLogP | -2.37 |
| TPSA | 197.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|