C5H13N3O6S — CID 175193978
2-(diaminomethylideneamino)butanoic acid;sulfuric acid (PubChem CID 175193978) has the molecular formula C5H13N3O6S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)butanoic acid;sulfuric acid.
| Compound Name | 2-(diaminomethylideneamino)butanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 175193978 |
| Molecular Formula | C5H13N3O6S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(diaminomethylideneamino)butanoic acid;sulfuric acid |
| SMILES | CCC(N=C(N)N)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C5H11N3O2.H2O4S/c1-2-3(4(9)10)8-5(6)7;1-5(2,3)4/h3H,2H2,1H3,(H,9,10)(H4,6,7,8);(H2,1,2,3,4) |
| InChIKey | CFFHRSJBCGGPDM-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 176.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|