2-(diaminomethylideneamino)butanoic acid;sulfuric acid

C5H13N3O6S — CID 175193978

IUPAC2-(diaminomethylideneamino)butanoic acid;sulfuric acid
SMILESCCC(N=C(N)N)C(=O)O.O=S(=O)(O)O
InChIInChI=1S/C5H11N3O2.H2O4S/c1-2-3(4(9)10)8-5(6)7;1-5(2,3)4/h3H,2H2,1H3,(H,9,10)(H4,6,7,8);(H2,1,2,3,4)
InChIKeyCFFHRSJBCGGPDM-UHFFFAOYSA-N
MW243.24 g/mol
LogP-1.53
Rot. Bonds3

About 2-(diaminomethylideneamino)butanoic acid;sulfuric acid

2-(diaminomethylideneamino)butanoic acid;sulfuric acid (PubChem CID 175193978) has the molecular formula C5H13N3O6S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)butanoic acid;sulfuric acid.

Molecular Properties

Compound Name2-(diaminomethylideneamino)butanoic acid;sulfuric acid
PubChem CID175193978
Molecular FormulaC5H13N3O6S
Molecular Weight243.24 g/mol
Exact Mass243.05
IUPAC Name2-(diaminomethylideneamino)butanoic acid;sulfuric acid
SMILESCCC(N=C(N)N)C(=O)O.O=S(=O)(O)O
InChIInChI=1S/C5H11N3O2.H2O4S/c1-2-3(4(9)10)8-5(6)7;1-5(2,3)4/h3H,2H2,1H3,(H,9,10)(H4,6,7,8);(H2,1,2,3,4)
InChIKeyCFFHRSJBCGGPDM-UHFFFAOYSA-N
XLogP-1.53
TPSA176.30 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.24
LogP ≤ 5-1.53
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(diaminomethylideneamino)butanoic acid;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(diaminomethylideneamino)butanoic acid;sulfuric acid?
The IUPAC name of 2-(diaminomethylideneamino)butanoic acid;sulfuric acid (CID 175193978) is 2-(diaminomethylideneamino)butanoic acid;sulfuric acid.
What is the SMILES notation for 2-(diaminomethylideneamino)butanoic acid;sulfuric acid?
The canonical SMILES for 2-(diaminomethylideneamino)butanoic acid;sulfuric acid is CCC(N=C(N)N)C(=O)O.O=S(=O)(O)O.
What is the InChIKey of 2-(diaminomethylideneamino)butanoic acid;sulfuric acid?
The InChIKey is CFFHRSJBCGGPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2.H2O4S/c1-2-3(4(9)10)8-5(6)7;1-5(2,3)4/h3H,2H2,1H3,(H,9,10)(H4,6,7,8);(H2,1,2,3,4).
What are the key properties of 2-(diaminomethylideneamino)butanoic acid;sulfuric acid?
2-(diaminomethylideneamino)butanoic acid;sulfuric acid has a molecular weight of 243.24 g/mol, XLogP of -1.53, 3 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diaminomethylideneamino)butanoic acid;sulfuric acid is sourced from PubChem (CID 175193978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).