C7H18N4O6S — CID 139024984
(2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;sulfuric acid (PubChem CID 139024984) has the molecular formula C7H18N4O6S and a molecular weight of 286.31 g/mol. Its IUPAC name is (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;sulfuric acid.
| Compound Name | (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 139024984 |
| Molecular Formula | C7H18N4O6S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;sulfuric acid |
| SMILES | NC(N)=NCCCC[C@@H](N)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C7H16N4O2.H2O4S/c8-5(6(12)13)3-1-2-4-11-7(9)10;1-5(2,3)4/h5H,1-4,8H2,(H,12,13)(H4,9,10,11);(H2,1,2,3,4)/t5-;/m1./s1 |
| InChIKey | WKALSGFQNULHQH-NUBCRITNSA-N |
| XLogP | -1.81 |
| TPSA | 202.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|