C12H25N5O6 — CID 157154468
(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;(2S)-2-aminopentanedioic acid (PubChem CID 157154468) has the molecular formula C12H25N5O6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;(2S)-2-aminopentanedioic acid.
| Compound Name | (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;(2S)-2-aminopentanedioic acid |
|---|---|
| PubChem CID | 157154468 |
| Molecular Formula | C12H25N5O6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;(2S)-2-aminopentanedioic acid |
| SMILES | NC(N)=NCCCC[C@H](N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H16N4O2.C5H9NO4/c8-5(6(12)13)3-1-2-4-11-7(9)10;6-3(5(9)10)1-2-4(7)8/h5H,1-4,8H2,(H,12,13)(H4,9,10,11);3H,1-2,6H2,(H,7,8)(H,9,10)/t5-;3-/m00/s1 |
| InChIKey | ALQLJHXDHABZKV-RVZXSAGBSA-N |
| XLogP | -1.89 |
| TPSA | 228.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|