C20H42N6O8 — CID 87962576
(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;2-aminoheptanedioic acid;(2S)-2-amino-4-methylpentanoic acid (PubChem CID 87962576) has the molecular formula C20H42N6O8 and a molecular weight of 494.59 g/mol. Its IUPAC name is (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;2-aminoheptanedioic acid;(2S)-2-amino-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;2-aminoheptanedioic acid;(2S)-2-amino-4-methylpentanoic acid |
|---|---|
| PubChem CID | 87962576 |
| Molecular Formula | C20H42N6O8 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid;2-aminoheptanedioic acid;(2S)-2-amino-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.NC(CCCCC(=O)O)C(=O)O.NC(N)=NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2.C7H13NO4.C6H13NO2/c8-5(6(12)13)3-1-2-4-11-7(9)10;8-5(7(11)12)3-1-2-4-6(9)10;1-4(2)3-5(7)6(8)9/h5H,1-4,8H2,(H,12,13)(H4,9,10,11);5H,1-4,8H2,(H,9,10)(H,11,12);4-5H,3,7H2,1-2H3,(H,8,9)/t5-;;5-/m0.0/s1 |
| InChIKey | KNDRQSWPYRQBDB-CMCOPSFCSA-N |
| XLogP | -0.67 |
| TPSA | 291.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|