C11H23N5O6 — CID 158816513
(2S)-2-aminobutanedioic acid;(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 158816513) has the molecular formula C11H23N5O6 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 158816513 |
| Molecular Formula | C11H23N5O6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | NC(N)=NCCCC[C@H](N)C(=O)O.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H16N4O2.C4H7NO4/c8-5(6(12)13)3-1-2-4-11-7(9)10;5-2(4(8)9)1-3(6)7/h5H,1-4,8H2,(H,12,13)(H4,9,10,11);2H,1,5H2,(H,6,7)(H,8,9)/t5-;2-/m00/s1 |
| InChIKey | IVIMAEJGCQNBQY-KNIFDHDWSA-N |
| XLogP | -2.29 |
| TPSA | 228.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|