C14H31N7O10 — CID 18362551
bis(2-aminoacetic acid);2-aminobutanedioic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18362551) has the molecular formula C14H31N7O10 and a molecular weight of 457.44 g/mol. Its IUPAC name is bis(2-aminoacetic acid);2-aminobutanedioic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | bis(2-aminoacetic acid);2-aminobutanedioic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18362551 |
| Molecular Formula | C14H31N7O10 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | bis(2-aminoacetic acid);2-aminobutanedioic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(CC(=O)O)C(=O)O.NC(N)=NCCCC(N)C(=O)O.NCC(=O)O.NCC(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H7NO4.2C2H5NO2/c7-4(5(11)12)2-1-3-10-6(8)9;5-2(4(8)9)1-3(6)7;2*3-1-2(4)5/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2H,1,5H2,(H,6,7)(H,8,9);2*1,3H2,(H,4,5) |
| InChIKey | FQJMMELDZQJBDH-UHFFFAOYSA-N |
| XLogP | -4.62 |
| TPSA | 354.98 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|