C8H19N5O4 — CID 22328371
2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22328371) has the molecular formula C8H19N5O4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22328371 |
| Molecular Formula | C8H19N5O4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-aminoacetic acid;2-amino-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.NCC(=O)O |
| InChI | InChI=1S/C6H14N4O2.C2H5NO2/c7-4(5(11)12)2-1-3-10-6(8)9;3-1-2(4)5/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1,3H2,(H,4,5) |
| InChIKey | IVNJKQPHHPMONX-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|