C10H24N6O4 — CID 122439105
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-diaminobutanoic acid (PubChem CID 122439105) has the molecular formula C10H24N6O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-diaminobutanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-diaminobutanoic acid |
|---|---|
| PubChem CID | 122439105 |
| Molecular Formula | C10H24N6O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-diaminobutanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.NCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H10N2O2/c7-4(5(11)12)2-1-3-10-6(8)9;5-2-1-3(6)4(7)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,5-6H2,(H,7,8)/t4-;/m0./s1 |
| InChIKey | GURGCHLBSSNCKO-WCCKRBBISA-N |
| XLogP | -2.80 |
| TPSA | 217.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|