C17H36N4O5 — CID 19069479
2-amino-5-(diaminomethylideneamino)pentanoic acid;10-hydroxyundecanoic acid (PubChem CID 19069479) has the molecular formula C17H36N4O5 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;10-hydroxyundecanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;10-hydroxyundecanoic acid |
|---|---|
| PubChem CID | 19069479 |
| Molecular Formula | C17H36N4O5 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;10-hydroxyundecanoic acid |
| SMILES | CC(O)CCCCCCCCC(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C11H22O3.C6H14N4O2/c1-10(12)8-6-4-2-3-5-7-9-11(13)14;7-4(5(11)12)2-1-3-10-6(8)9/h10,12H,2-9H2,1H3,(H,13,14);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | SLEATKVZTPZYEZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|