C8H22N4O4S — CID 175147210
2-amino-5-(diaminomethylideneamino)pentanoic acid;1-sulfanylethanol;hydrate (PubChem CID 175147210) has the molecular formula C8H22N4O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;1-sulfanylethanol;hydrate.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;1-sulfanylethanol;hydrate |
|---|---|
| PubChem CID | 175147210 |
| Molecular Formula | C8H22N4O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;1-sulfanylethanol;hydrate |
| SMILES | CC(O)S.NC(N)=NCCCC(N)C(=O)O.O |
| InChI | InChI=1S/C6H14N4O2.C2H6OS.H2O/c7-4(5(11)12)2-1-3-10-6(8)9;1-2(3)4;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-4H,1H3;1H2 |
| InChIKey | LEQQAGJKUFTIDS-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 179.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|