C9H21N5O4S — CID 87534543
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 87534543) has the molecular formula C9H21N5O4S and a molecular weight of 295.37 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87534543 |
| Molecular Formula | C9H21N5O4S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C3H7NO2S/c7-4(5(11)12)2-1-3-10-6(8)9;4-2(1-7)3(5)6/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2,7H,1,4H2,(H,5,6)/t4-;2-/m00/s1 |
| InChIKey | APYZGXYHYSFUDF-ZBRNBAAYSA-N |
| XLogP | -2.22 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|