C7H11N3O4 — CID 174359279
2-(diaminomethylideneamino)-4-ethenoxy-4-oxobutanoic acid (PubChem CID 174359279) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-4-ethenoxy-4-oxobutanoic acid.
| Compound Name | 2-(diaminomethylideneamino)-4-ethenoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174359279 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-(diaminomethylideneamino)-4-ethenoxy-4-oxobutanoic acid |
| SMILES | C=COC(=O)CC(N=C(N)N)C(=O)O |
| InChI | InChI=1S/C7H11N3O4/c1-2-14-5(11)3-4(6(12)13)10-7(8)9/h2,4H,1,3H2,(H,12,13)(H4,8,9,10) |
| InChIKey | VWJCUZYBLWKKTG-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|