About ethenyl 4-aminobut-3-enoate
ethenyl 4-aminobut-3-enoate (PubChem CID 173333237) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is ethenyl 4-aminobut-3-enoate.
Molecular Properties
| Compound Name | ethenyl 4-aminobut-3-enoate |
| PubChem CID | 173333237 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | ethenyl 4-aminobut-3-enoate |
| SMILES | C=COC(=O)CC=CN |
| InChI | InChI=1S/C6H9NO2/c1-2-9-6(8)4-3-5-7/h2-3,5H,1,4,7H2 |
| InChIKey | JKZAGTIHXBIUDN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 4-aminobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 4-aminobut-3-enoate?
The IUPAC name of ethenyl 4-aminobut-3-enoate (CID 173333237) is ethenyl 4-aminobut-3-enoate.
What is the SMILES notation for ethenyl 4-aminobut-3-enoate?
The canonical SMILES for ethenyl 4-aminobut-3-enoate is C=COC(=O)CC=CN.
What is the InChIKey of ethenyl 4-aminobut-3-enoate?
The InChIKey is JKZAGTIHXBIUDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-2-9-6(8)4-3-5-7/h2-3,5H,1,4,7H2.
What are the key properties of ethenyl 4-aminobut-3-enoate?
ethenyl 4-aminobut-3-enoate has a molecular weight of 127.14 g/mol, XLogP of 0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 4-aminobut-3-enoate is sourced from PubChem (CID 173333237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).