About (2-ethenoxy-2-oxoethyl) prop-2-enoate
(2-ethenoxy-2-oxoethyl) prop-2-enoate (PubChem CID 18411317) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (2-ethenoxy-2-oxoethyl) prop-2-enoate.
Molecular Properties
| Compound Name | (2-ethenoxy-2-oxoethyl) prop-2-enoate |
| PubChem CID | 18411317 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (2-ethenoxy-2-oxoethyl) prop-2-enoate |
| SMILES | C=COC(=O)COC(=O)C=C |
| InChI | InChI=1S/C7H8O4/c1-3-6(8)11-5-7(9)10-4-2/h3-4H,1-2,5H2 |
| InChIKey | PKPSBLGBZNZAST-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-ethenoxy-2-oxoethyl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethenoxy-2-oxoethyl) prop-2-enoate?
The IUPAC name of (2-ethenoxy-2-oxoethyl) prop-2-enoate (CID 18411317) is (2-ethenoxy-2-oxoethyl) prop-2-enoate.
What is the SMILES notation for (2-ethenoxy-2-oxoethyl) prop-2-enoate?
The canonical SMILES for (2-ethenoxy-2-oxoethyl) prop-2-enoate is C=COC(=O)COC(=O)C=C.
What is the InChIKey of (2-ethenoxy-2-oxoethyl) prop-2-enoate?
The InChIKey is PKPSBLGBZNZAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-3-6(8)11-5-7(9)10-4-2/h3-4H,1-2,5H2.
What are the key properties of (2-ethenoxy-2-oxoethyl) prop-2-enoate?
(2-ethenoxy-2-oxoethyl) prop-2-enoate has a molecular weight of 156.14 g/mol, XLogP of 0.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethenoxy-2-oxoethyl) prop-2-enoate is sourced from PubChem (CID 18411317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).