About [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane
[2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane (PubChem CID 161479127) has the molecular formula C14H34O7
and a molecular weight of 314.42 g/mol. Its IUPAC name is [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane.
Molecular Properties
| Compound Name | [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane |
| PubChem CID | 161479127 |
| Molecular Formula | C14H34O7 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane |
| SMILES | C.C.C.C.C.C.C=CC(=O)OCOC(=O)COC(=O)CO |
| InChI | InChI=1S/C8H10O7.6CH4/c1-2-6(10)14-5-15-8(12)4-13-7(11)3-9;;;;;;/h2,9H,1,3-5H2;6*1H4 |
| InChIKey | WECSONGGHOKKAW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane?
The IUPAC name of [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane (CID 161479127) is [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane.
What is the SMILES notation for [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane?
The canonical SMILES for [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane is C.C.C.C.C.C.C=CC(=O)OCOC(=O)COC(=O)CO.
What is the InChIKey of [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane?
The InChIKey is WECSONGGHOKKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O7.6CH4/c1-2-6(10)14-5-15-8(12)4-13-7(11)3-9;;;;;;/h2,9H,1,3-5H2;6*1H4.
What are the key properties of [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane?
[2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane has a molecular weight of 314.42 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-hydroxyacetyl)oxyacetyl]oxymethyl prop-2-enoate;methane is sourced from PubChem (CID 161479127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).