C9H14O6 — CID 138520908
ethane-1,2-diol;prop-2-enoyloxymethyl prop-2-enoate (PubChem CID 138520908) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is ethane-1,2-diol;prop-2-enoyloxymethyl prop-2-enoate.
| Compound Name | ethane-1,2-diol;prop-2-enoyloxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 138520908 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | ethane-1,2-diol;prop-2-enoyloxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC(=O)C=C.OCCO |
| InChI | InChI=1S/C7H8O4.C2H6O2/c1-3-6(8)10-5-11-7(9)4-2;3-1-2-4/h3-4H,1-2,5H2;3-4H,1-2H2 |
| InChIKey | UEYSOYPYUYKCLG-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|