C13H19ClO7 — CID 160715574
ethane-1,2-diol;prop-2-enoyl chloride;2-prop-2-enoyloxyethyl prop-2-enoate (PubChem CID 160715574) has the molecular formula C13H19ClO7 and a molecular weight of 322.74 g/mol. Its IUPAC name is ethane-1,2-diol;prop-2-enoyl chloride;2-prop-2-enoyloxyethyl prop-2-enoate.
| Compound Name | ethane-1,2-diol;prop-2-enoyl chloride;2-prop-2-enoyloxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 160715574 |
| Molecular Formula | C13H19ClO7 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | ethane-1,2-diol;prop-2-enoyl chloride;2-prop-2-enoyloxyethyl prop-2-enoate |
| SMILES | C=CC(=O)Cl.C=CC(=O)OCCOC(=O)C=C.OCCO |
| InChI | InChI=1S/C8H10O4.C3H3ClO.C2H6O2/c1-3-7(9)11-5-6-12-8(10)4-2;1-2-3(4)5;3-1-2-4/h3-4H,1-2,5-6H2;2H,1H2;3-4H,1-2H2 |
| InChIKey | RSKQVMOBPDGOAQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|