About 2-chloroethyl prop-2-enoate
2-chloroethyl prop-2-enoate (PubChem CID 16627) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is 2-chloroethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-chloroethyl prop-2-enoate |
| PubChem CID | 16627 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 2-chloroethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCl |
| InChI | InChI=1S/C5H7ClO2/c1-2-5(7)8-4-3-6/h2H,1,3-4H2 |
| InChIKey | WHBAYNMEIXUTJV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl prop-2-enoate?
The IUPAC name of 2-chloroethyl prop-2-enoate (CID 16627) is 2-chloroethyl prop-2-enoate.
What is the SMILES notation for 2-chloroethyl prop-2-enoate?
The canonical SMILES for 2-chloroethyl prop-2-enoate is C=CC(=O)OCCCl.
What is the InChIKey of 2-chloroethyl prop-2-enoate?
The InChIKey is WHBAYNMEIXUTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-2-5(7)8-4-3-6/h2H,1,3-4H2.
What are the key properties of 2-chloroethyl prop-2-enoate?
2-chloroethyl prop-2-enoate has a molecular weight of 134.56 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl prop-2-enoate is sourced from PubChem (CID 16627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).