About (2-ethoxy-2-oxoethyl) 2-hydroxyacetate
(2-ethoxy-2-oxoethyl) 2-hydroxyacetate (PubChem CID 57037342) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) 2-hydroxyacetate |
| PubChem CID | 57037342 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-hydroxyacetate |
| SMILES | CCOC(=O)COC(=O)CO |
| InChI | InChI=1S/C6H10O5/c1-2-10-6(9)4-11-5(8)3-7/h7H,2-4H2,1H3 |
| InChIKey | RYXAYHMDEIXDRJ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethoxy-2-oxoethyl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 2-hydroxyacetate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 2-hydroxyacetate (CID 57037342) is (2-ethoxy-2-oxoethyl) 2-hydroxyacetate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 2-hydroxyacetate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 2-hydroxyacetate is CCOC(=O)COC(=O)CO.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 2-hydroxyacetate?
The InChIKey is RYXAYHMDEIXDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5/c1-2-10-6(9)4-11-5(8)3-7/h7H,2-4H2,1H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 2-hydroxyacetate?
(2-ethoxy-2-oxoethyl) 2-hydroxyacetate has a molecular weight of 162.14 g/mol, XLogP of -0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 2-hydroxyacetate is sourced from PubChem (CID 57037342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).