About barium(2+);ethyl 2-hydroxyacetate;hydride
barium(2+);ethyl 2-hydroxyacetate;hydride (PubChem CID 173419911) has the molecular formula C4H10BaO3
and a molecular weight of 243.45 g/mol. Its IUPAC name is barium(2+);ethyl 2-hydroxyacetate;hydride.
Molecular Properties
| Compound Name | barium(2+);ethyl 2-hydroxyacetate;hydride |
| PubChem CID | 173419911 |
| Molecular Formula | C4H10BaO3 |
| Molecular Weight | 243.45 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | barium(2+);ethyl 2-hydroxyacetate;hydride |
| SMILES | CCOC(=O)CO.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C4H8O3.Ba.2H/c1-2-7-4(6)3-5;;;/h5H,2-3H2,1H3;;;/q;+2;2*-1 |
| InChIKey | JWQFCUFINVAOMB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.45 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze barium(2+);ethyl 2-hydroxyacetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);ethyl 2-hydroxyacetate;hydride?
The IUPAC name of barium(2+);ethyl 2-hydroxyacetate;hydride (CID 173419911) is barium(2+);ethyl 2-hydroxyacetate;hydride.
What is the SMILES notation for barium(2+);ethyl 2-hydroxyacetate;hydride?
The canonical SMILES for barium(2+);ethyl 2-hydroxyacetate;hydride is CCOC(=O)CO.[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);ethyl 2-hydroxyacetate;hydride?
The InChIKey is JWQFCUFINVAOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.Ba.2H/c1-2-7-4(6)3-5;;;/h5H,2-3H2,1H3;;;/q;+2;2*-1.
What are the key properties of barium(2+);ethyl 2-hydroxyacetate;hydride?
barium(2+);ethyl 2-hydroxyacetate;hydride has a molecular weight of 243.45 g/mol, XLogP of -0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);ethyl 2-hydroxyacetate;hydride is sourced from PubChem (CID 173419911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).