About calcium;ethyl propanoate;hydride
calcium;ethyl propanoate;hydride (PubChem CID 173132885) has the molecular formula C5H12CaO2
and a molecular weight of 144.23 g/mol. Its IUPAC name is calcium;ethyl propanoate;hydride.
Molecular Properties
| Compound Name | calcium;ethyl propanoate;hydride |
| PubChem CID | 173132885 |
| Molecular Formula | C5H12CaO2 |
| Molecular Weight | 144.23 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | calcium;ethyl propanoate;hydride |
| SMILES | CCOC(=O)CC.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C5H10O2.Ca.2H/c1-3-5(6)7-4-2;;;/h3-4H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | NALWKAUAUMPLJA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;ethyl propanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;ethyl propanoate;hydride?
The IUPAC name of calcium;ethyl propanoate;hydride (CID 173132885) is calcium;ethyl propanoate;hydride.
What is the SMILES notation for calcium;ethyl propanoate;hydride?
The canonical SMILES for calcium;ethyl propanoate;hydride is CCOC(=O)CC.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;ethyl propanoate;hydride?
The InChIKey is NALWKAUAUMPLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.Ca.2H/c1-3-5(6)7-4-2;;;/h3-4H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of calcium;ethyl propanoate;hydride?
calcium;ethyl propanoate;hydride has a molecular weight of 144.23 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;ethyl propanoate;hydride is sourced from PubChem (CID 173132885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).