About ethyl propanoate;titanium(4+);tetrachloride
ethyl propanoate;titanium(4+);tetrachloride (PubChem CID 173205872) has the molecular formula C5H10Cl4O2Ti
and a molecular weight of 291.81 g/mol. Its IUPAC name is ethyl propanoate;titanium(4+);tetrachloride.
Molecular Properties
| Compound Name | ethyl propanoate;titanium(4+);tetrachloride |
| PubChem CID | 173205872 |
| Molecular Formula | C5H10Cl4O2Ti |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | ethyl propanoate;titanium(4+);tetrachloride |
| SMILES | CCOC(=O)CC.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C5H10O2.4ClH.Ti/c1-3-5(6)7-4-2;;;;;/h3-4H2,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | UXMZFVOERWBQEJ-UHFFFAOYSA-J |
| XLogP | -11.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | -11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl propanoate;titanium(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl propanoate;titanium(4+);tetrachloride?
The IUPAC name of ethyl propanoate;titanium(4+);tetrachloride (CID 173205872) is ethyl propanoate;titanium(4+);tetrachloride.
What is the SMILES notation for ethyl propanoate;titanium(4+);tetrachloride?
The canonical SMILES for ethyl propanoate;titanium(4+);tetrachloride is CCOC(=O)CC.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of ethyl propanoate;titanium(4+);tetrachloride?
The InChIKey is UXMZFVOERWBQEJ-UHFFFAOYSA-J. The full InChI is InChI=1S/C5H10O2.4ClH.Ti/c1-3-5(6)7-4-2;;;;;/h3-4H2,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of ethyl propanoate;titanium(4+);tetrachloride?
ethyl propanoate;titanium(4+);tetrachloride has a molecular weight of 291.81 g/mol, XLogP of -11.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl propanoate;titanium(4+);tetrachloride is sourced from PubChem (CID 173205872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).