About (2-ethoxy-2-oxoethyl) propanoate
(2-ethoxy-2-oxoethyl) propanoate (PubChem CID 13301802) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) propanoate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) propanoate |
| PubChem CID | 13301802 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) propanoate |
| SMILES | CCOC(=O)COC(=O)CC |
| InChI | InChI=1S/C7H12O4/c1-3-6(8)11-5-7(9)10-4-2/h3-5H2,1-2H3 |
| InChIKey | FNZORUKVFBUINO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethoxy-2-oxoethyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) propanoate?
The IUPAC name of (2-ethoxy-2-oxoethyl) propanoate (CID 13301802) is (2-ethoxy-2-oxoethyl) propanoate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) propanoate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) propanoate is CCOC(=O)COC(=O)CC.
What is the InChIKey of (2-ethoxy-2-oxoethyl) propanoate?
The InChIKey is FNZORUKVFBUINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-3-6(8)11-5-7(9)10-4-2/h3-5H2,1-2H3.
What are the key properties of (2-ethoxy-2-oxoethyl) propanoate?
(2-ethoxy-2-oxoethyl) propanoate has a molecular weight of 160.17 g/mol, XLogP of 0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) propanoate is sourced from PubChem (CID 13301802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).