About sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate
sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate (PubChem CID 175477931) has the molecular formula C8H13NaO5
and a molecular weight of 212.18 g/mol. Its IUPAC name is sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate.
Molecular Properties
| Compound Name | sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate |
| PubChem CID | 175477931 |
| Molecular Formula | C8H13NaO5 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate |
| SMILES | CCC(=O)OCC(=O)OC(=O)CC.[H-].[Na+] |
| InChI | InChI=1S/C8H12O5.Na.H/c1-3-6(9)12-5-8(11)13-7(10)4-2;;/h3-5H2,1-2H3;;/q;+1;-1 |
| InChIKey | YRGZPCUWPNSOQH-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate?
The IUPAC name of sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate (CID 175477931) is sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate.
What is the SMILES notation for sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate?
The canonical SMILES for sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate is CCC(=O)OCC(=O)OC(=O)CC.[H-].[Na+].
What is the InChIKey of sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate?
The InChIKey is YRGZPCUWPNSOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5.Na.H/c1-3-6(9)12-5-8(11)13-7(10)4-2;;/h3-5H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate?
sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate has a molecular weight of 212.18 g/mol, XLogP of -2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(2-oxo-2-propanoyloxyethyl) propanoate is sourced from PubChem (CID 175477931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).