About N-ethylpropanamide;ethyl propanoate
N-ethylpropanamide;ethyl propanoate (PubChem CID 90984827) has the molecular formula C10H21NO3
and a molecular weight of 203.28 g/mol. Its IUPAC name is N-ethylpropanamide;ethyl propanoate.
Molecular Properties
| Compound Name | N-ethylpropanamide;ethyl propanoate |
| PubChem CID | 90984827 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-ethylpropanamide;ethyl propanoate |
| SMILES | CCNC(=O)CC.CCOC(=O)CC |
| InChI | InChI=1S/C5H11NO.C5H10O2/c1-3-5(7)6-4-2;1-3-5(6)7-4-2/h3-4H2,1-2H3,(H,6,7);3-4H2,1-2H3 |
| InChIKey | DPJKETBKXUGCQH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylpropanamide;ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpropanamide;ethyl propanoate?
The IUPAC name of N-ethylpropanamide;ethyl propanoate (CID 90984827) is N-ethylpropanamide;ethyl propanoate.
What is the SMILES notation for N-ethylpropanamide;ethyl propanoate?
The canonical SMILES for N-ethylpropanamide;ethyl propanoate is CCNC(=O)CC.CCOC(=O)CC.
What is the InChIKey of N-ethylpropanamide;ethyl propanoate?
The InChIKey is DPJKETBKXUGCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C5H10O2/c1-3-5(7)6-4-2;1-3-5(6)7-4-2/h3-4H2,1-2H3,(H,6,7);3-4H2,1-2H3.
What are the key properties of N-ethylpropanamide;ethyl propanoate?
N-ethylpropanamide;ethyl propanoate has a molecular weight of 203.28 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpropanamide;ethyl propanoate is sourced from PubChem (CID 90984827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).