About acetylene;N-ethylpropanamide
acetylene;N-ethylpropanamide (PubChem CID 143477358) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is acetylene;N-ethylpropanamide.
Molecular Properties
| Compound Name | acetylene;N-ethylpropanamide |
| PubChem CID | 143477358 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | acetylene;N-ethylpropanamide |
| SMILES | C#C.CCNC(=O)CC |
| InChI | InChI=1S/C5H11NO.C2H2/c1-3-5(7)6-4-2;1-2/h3-4H2,1-2H3,(H,6,7);1-2H |
| InChIKey | GGJCTPICOHCDJO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;N-ethylpropanamide?
The IUPAC name of acetylene;N-ethylpropanamide (CID 143477358) is acetylene;N-ethylpropanamide.
What is the SMILES notation for acetylene;N-ethylpropanamide?
The canonical SMILES for acetylene;N-ethylpropanamide is C#C.CCNC(=O)CC.
What is the InChIKey of acetylene;N-ethylpropanamide?
The InChIKey is GGJCTPICOHCDJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2H2/c1-3-5(7)6-4-2;1-2/h3-4H2,1-2H3,(H,6,7);1-2H.
What are the key properties of acetylene;N-ethylpropanamide?
acetylene;N-ethylpropanamide has a molecular weight of 127.19 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;N-ethylpropanamide is sourced from PubChem (CID 143477358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).