About N-ethylpropanamide tetrafluoroborate
N-ethylpropanamide tetrafluoroborate (PubChem CID 88753462) has the molecular formula C5H11BF4NO-
and a molecular weight of 187.95 g/mol. Its IUPAC name is N-ethylpropanamide tetrafluoroborate.
Molecular Properties
| Compound Name | N-ethylpropanamide tetrafluoroborate |
| PubChem CID | 88753462 |
| Molecular Formula | C5H11BF4NO- |
| Molecular Weight | 187.95 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-ethylpropanamide tetrafluoroborate |
| SMILES | CCNC(=O)CC.F[B-](F)(F)F |
| InChI | InChI=1S/C5H11NO.BF4/c1-3-5(7)6-4-2;2-1(3,4)5/h3-4H2,1-2H3,(H,6,7);/q;-1 |
| InChIKey | YMXBRAFIHLEQAC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.95 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethylpropanamide tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpropanamide tetrafluoroborate?
The IUPAC name of N-ethylpropanamide tetrafluoroborate (CID 88753462) is N-ethylpropanamide tetrafluoroborate.
What is the SMILES notation for N-ethylpropanamide tetrafluoroborate?
The canonical SMILES for N-ethylpropanamide tetrafluoroborate is CCNC(=O)CC.F[B-](F)(F)F.
What is the InChIKey of N-ethylpropanamide tetrafluoroborate?
The InChIKey is YMXBRAFIHLEQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.BF4/c1-3-5(7)6-4-2;2-1(3,4)5/h3-4H2,1-2H3,(H,6,7);/q;-1.
What are the key properties of N-ethylpropanamide tetrafluoroborate?
N-ethylpropanamide tetrafluoroborate has a molecular weight of 187.95 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpropanamide tetrafluoroborate is sourced from PubChem (CID 88753462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).