About ethanamine;ethane;N-ethylpropanamide
ethanamine;ethane;N-ethylpropanamide (PubChem CID 157433415) has the molecular formula C9H24N2O
and a molecular weight of 176.30 g/mol. Its IUPAC name is ethanamine;ethane;N-ethylpropanamide.
Molecular Properties
| Compound Name | ethanamine;ethane;N-ethylpropanamide |
| PubChem CID | 157433415 |
| Molecular Formula | C9H24N2O |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.19 |
| IUPAC Name | ethanamine;ethane;N-ethylpropanamide |
| SMILES | CC.CCN.CCNC(=O)CC |
| InChI | InChI=1S/C5H11NO.C2H7N.C2H6/c1-3-5(7)6-4-2;1-2-3;1-2/h3-4H2,1-2H3,(H,6,7);2-3H2,1H3;1-2H3 |
| InChIKey | BQUVUTBPKMKMNA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanamine;ethane;N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;ethane;N-ethylpropanamide?
The IUPAC name of ethanamine;ethane;N-ethylpropanamide (CID 157433415) is ethanamine;ethane;N-ethylpropanamide.
What is the SMILES notation for ethanamine;ethane;N-ethylpropanamide?
The canonical SMILES for ethanamine;ethane;N-ethylpropanamide is CC.CCN.CCNC(=O)CC.
What is the InChIKey of ethanamine;ethane;N-ethylpropanamide?
The InChIKey is BQUVUTBPKMKMNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2H7N.C2H6/c1-3-5(7)6-4-2;1-2-3;1-2/h3-4H2,1-2H3,(H,6,7);2-3H2,1H3;1-2H3.
What are the key properties of ethanamine;ethane;N-ethylpropanamide?
ethanamine;ethane;N-ethylpropanamide has a molecular weight of 176.30 g/mol, XLogP of 1.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;ethane;N-ethylpropanamide is sourced from PubChem (CID 157433415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).