About ethane;propanehydrazide
ethane;propanehydrazide (PubChem CID 143310399) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is ethane;propanehydrazide.
Molecular Properties
| Compound Name | ethane;propanehydrazide |
| PubChem CID | 143310399 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | ethane;propanehydrazide |
| SMILES | CC.CCC(=O)NN |
| InChI | InChI=1S/C3H8N2O.C2H6/c1-2-3(6)5-4;1-2/h2,4H2,1H3,(H,5,6);1-2H3 |
| InChIKey | PMZKTAJTDPZHGG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propanehydrazide?
The IUPAC name of ethane;propanehydrazide (CID 143310399) is ethane;propanehydrazide.
What is the SMILES notation for ethane;propanehydrazide?
The canonical SMILES for ethane;propanehydrazide is CC.CCC(=O)NN.
What is the InChIKey of ethane;propanehydrazide?
The InChIKey is PMZKTAJTDPZHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.C2H6/c1-2-3(6)5-4;1-2/h2,4H2,1H3,(H,5,6);1-2H3.
What are the key properties of ethane;propanehydrazide?
ethane;propanehydrazide has a molecular weight of 118.18 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propanehydrazide is sourced from PubChem (CID 143310399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).