About azane;propanehydrazide;hydroiodide
azane;propanehydrazide;hydroiodide (PubChem CID 174716911) has the molecular formula C3H12IN3O
and a molecular weight of 233.05 g/mol. Its IUPAC name is azane;propanehydrazide;hydroiodide.
Molecular Properties
| Compound Name | azane;propanehydrazide;hydroiodide |
| PubChem CID | 174716911 |
| Molecular Formula | C3H12IN3O |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | azane;propanehydrazide;hydroiodide |
| SMILES | CCC(=O)NN.I.N |
| InChI | InChI=1S/C3H8N2O.HI.H3N/c1-2-3(6)5-4;;/h2,4H2,1H3,(H,5,6);1H;1H3 |
| InChIKey | SSGACDPDWPTBCZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;propanehydrazide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propanehydrazide;hydroiodide?
The IUPAC name of azane;propanehydrazide;hydroiodide (CID 174716911) is azane;propanehydrazide;hydroiodide.
What is the SMILES notation for azane;propanehydrazide;hydroiodide?
The canonical SMILES for azane;propanehydrazide;hydroiodide is CCC(=O)NN.I.N.
What is the InChIKey of azane;propanehydrazide;hydroiodide?
The InChIKey is SSGACDPDWPTBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.HI.H3N/c1-2-3(6)5-4;;/h2,4H2,1H3,(H,5,6);1H;1H3.
What are the key properties of azane;propanehydrazide;hydroiodide?
azane;propanehydrazide;hydroiodide has a molecular weight of 233.05 g/mol, XLogP of 0.17, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propanehydrazide;hydroiodide is sourced from PubChem (CID 174716911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).