About 2-ethoxyacetohydrazide;hydrochloride
2-ethoxyacetohydrazide;hydrochloride (PubChem CID 16641296) has the molecular formula C4H11ClN2O2
and a molecular weight of 154.60 g/mol. Its IUPAC name is 2-ethoxyacetohydrazide;hydrochloride.
Molecular Properties
| Compound Name | 2-ethoxyacetohydrazide;hydrochloride |
| PubChem CID | 16641296 |
| Molecular Formula | C4H11ClN2O2 |
| Molecular Weight | 154.60 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2-ethoxyacetohydrazide;hydrochloride |
| SMILES | CCOCC(=O)NN.Cl |
| InChI | InChI=1S/C4H10N2O2.ClH/c1-2-8-3-4(7)6-5;/h2-3,5H2,1H3,(H,6,7);1H |
| InChIKey | QJHKFYAAHZNVJB-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.60 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyacetohydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyacetohydrazide;hydrochloride?
The IUPAC name of 2-ethoxyacetohydrazide;hydrochloride (CID 16641296) is 2-ethoxyacetohydrazide;hydrochloride.
What is the SMILES notation for 2-ethoxyacetohydrazide;hydrochloride?
The canonical SMILES for 2-ethoxyacetohydrazide;hydrochloride is CCOCC(=O)NN.Cl.
What is the InChIKey of 2-ethoxyacetohydrazide;hydrochloride?
The InChIKey is QJHKFYAAHZNVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2.ClH/c1-2-8-3-4(7)6-5;/h2-3,5H2,1H3,(H,6,7);1H.
What are the key properties of 2-ethoxyacetohydrazide;hydrochloride?
2-ethoxyacetohydrazide;hydrochloride has a molecular weight of 154.60 g/mol, XLogP of -0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyacetohydrazide;hydrochloride is sourced from PubChem (CID 16641296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).