C7H14N2O3 — CID 64591348
3-[(2-ethoxyacetyl)amino]propanamide (PubChem CID 64591348) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-[(2-ethoxyacetyl)amino]propanamide.
| Compound Name | 3-[(2-ethoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 64591348 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-[(2-ethoxyacetyl)amino]propanamide |
| SMILES | CCOCC(=O)NCCC(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-2-12-5-7(11)9-4-3-6(8)10/h2-5H2,1H3,(H2,8,10)(H,9,11) |
| InChIKey | XXKZWWMSGROZPV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |