2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen

C14H29NO3 — CID 171554520

IUPAC2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen
SMILESCCOCC(=O)NCCCCCCCC(=O)CC.[H][H]
InChIInChI=1S/C14H27NO3.H2/c1-3-13(16)10-8-6-5-7-9-11-15-14(17)12-18-4-2;/h3-12H2,1-2H3,(H,15,17);1H
InChIKeyGTZOKDGFAUNDRK-UHFFFAOYSA-N
MW259.39 g/mol
LogP2.70
Rot. Bonds12

About 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen

2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen (PubChem CID 171554520) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen.

Molecular Properties

Compound Name2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen
PubChem CID171554520
Molecular FormulaC14H29NO3
Molecular Weight259.39 g/mol
Exact Mass259.21
IUPAC Name2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen
SMILESCCOCC(=O)NCCCCCCCC(=O)CC.[H][H]
InChIInChI=1S/C14H27NO3.H2/c1-3-13(16)10-8-6-5-7-9-11-15-14(17)12-18-4-2;/h3-12H2,1-2H3,(H,15,17);1H
InChIKeyGTZOKDGFAUNDRK-UHFFFAOYSA-N
XLogP2.70
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds12
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.39
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen?
The IUPAC name of 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen (CID 171554520) is 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen.
What is the SMILES notation for 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen?
The canonical SMILES for 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen is CCOCC(=O)NCCCCCCCC(=O)CC.[H][H].
What is the InChIKey of 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen?
The InChIKey is GTZOKDGFAUNDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3.H2/c1-3-13(16)10-8-6-5-7-9-11-15-14(17)12-18-4-2;/h3-12H2,1-2H3,(H,15,17);1H.
What are the key properties of 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen?
2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen has a molecular weight of 259.39 g/mol, XLogP of 2.70, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-(8-oxodecyl)acetamide;molecular hydrogen is sourced from PubChem (CID 171554520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).