C17H31NO5 — CID 58079400
N-[2-[2-(2,8-dioxodecoxy)ethoxy]ethyl]propanamide (PubChem CID 58079400) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[2-[2-(2,8-dioxodecoxy)ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-(2,8-dioxodecoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 58079400 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | N-[2-[2-(2,8-dioxodecoxy)ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)CCCCCC(=O)COCCOCCNC(=O)CC |
| InChI | InChI=1S/C17H31NO5/c1-3-15(19)8-6-5-7-9-16(20)14-23-13-12-22-11-10-18-17(21)4-2/h3-14H2,1-2H3,(H,18,21) |
| InChIKey | ATVXVEPDDMDTPD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|